C12H13ClN4O4S2 — CID 108780347
4-chloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 108780347) has the molecular formula C12H13ClN4O4S2 and a molecular weight of 376.85 g/mol. Its IUPAC name is 4-chloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 108780347 |
| Molecular Formula | C12H13ClN4O4S2 |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.01 |
| IUPAC Name | 4-chloro-N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)Cc1csc(NS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C12H13ClN4O4S2/c1-16(2)6-8-7-22-12(14-8)15-23(20,21)9-3-4-10(13)11(5-9)17(18)19/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | DYZHUIYDVZXERU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|