C18H15ClN4O5S2 — CID 108782673
N-[[4-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide (PubChem CID 108782673) has the molecular formula C18H15ClN4O5S2 and a molecular weight of 466.93 g/mol. Its IUPAC name is N-[[4-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 108782673 |
| Molecular Formula | C18H15ClN4O5S2 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | N-[[4-[2-[(4-chloro-3-nitrophenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NS(=O)(=O)c3ccc(Cl)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C18H15ClN4O5S2/c1-11(24)20-9-12-2-4-13(5-3-12)16-10-29-18(21-16)22-30(27,28)14-6-7-15(19)17(8-14)23(25)26/h2-8,10H,9H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | DWCMFJQQTBCUHT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|