C19H18ClN3O4S2 — CID 108782675
N-[[4-[2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide (PubChem CID 108782675) has the molecular formula C19H18ClN3O4S2 and a molecular weight of 451.96 g/mol. Its IUPAC name is N-[[4-[2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 108782675 |
| Molecular Formula | C19H18ClN3O4S2 |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-[[4-[2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)Nc1nc(-c2ccc(CNC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C19H18ClN3O4S2/c1-12(24)21-10-13-3-5-14(6-4-13)16-11-28-19(22-16)23-29(25,26)18-9-15(20)7-8-17(18)27-2/h3-9,11H,10H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | JPLUBKUJPDDLPY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|