C15H9Cl2FN2O2S2 — CID 71396289
2,5-dichloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 71396289) has the molecular formula C15H9Cl2FN2O2S2 and a molecular weight of 403.29 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 71396289 |
| Molecular Formula | C15H9Cl2FN2O2S2 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 2,5-dichloro-N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccc(F)cc2)cs1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl2FN2O2S2/c16-10-3-6-12(17)14(7-10)24(21,22)20-15-19-13(8-23-15)9-1-4-11(18)5-2-9/h1-8H,(H,19,20) |
| InChIKey | BMWGPASLZDRPBW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|