C15H9ClF2N2O2S2 — CID 3748114
N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzenesulfonamide (PubChem CID 3748114) has the molecular formula C15H9ClF2N2O2S2 and a molecular weight of 386.83 g/mol. Its IUPAC name is N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3748114 |
| Molecular Formula | C15H9ClF2N2O2S2 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccccc2Cl)cs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H9ClF2N2O2S2/c16-11-4-2-1-3-10(11)13-8-23-15(19-13)20-24(21,22)14-6-5-9(17)7-12(14)18/h1-8H,(H,19,20) |
| InChIKey | GRRCVZVORVCCDH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|