C15H12ClN3O2S2 — CID 10761363
4-amino-2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 10761363) has the molecular formula C15H12ClN3O2S2 and a molecular weight of 365.87 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10761363 |
| Molecular Formula | C15H12ClN3O2S2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-amino-2-chloro-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2nc(-c3ccccc3)cs2)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClN3O2S2/c16-12-8-11(17)6-7-14(12)23(20,21)19-15-18-13(9-22-15)10-4-2-1-3-5-10/h1-9H,17H2,(H,18,19) |
| InChIKey | XKOFDANRUFTDMA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|