C19H22N2O2S2 — CID 90842938
3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide;ethane (PubChem CID 90842938) has the molecular formula C19H22N2O2S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide;ethane.
| Compound Name | 3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide;ethane |
|---|---|
| PubChem CID | 90842938 |
| Molecular Formula | C19H22N2O2S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3,4-dimethyl-N-(4-phenyl-1,3-thiazol-2-yl)benzenesulfonamide;ethane |
| SMILES | CC.Cc1ccc(S(=O)(=O)Nc2nc(-c3ccccc3)cs2)cc1C |
| InChI | InChI=1S/C17H16N2O2S2.C2H6/c1-12-8-9-15(10-13(12)2)23(20,21)19-17-18-16(11-22-17)14-6-4-3-5-7-14;1-2/h3-11H,1-2H3,(H,18,19);1-2H3 |
| InChIKey | CIVWHDDTSMEZAG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|