C19H22N2S — CID 91283216
N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine;ethane (PubChem CID 91283216) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine;ethane.
| Compound Name | N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 91283216 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine;ethane |
| SMILES | CC.Cc1ccc(Nc2nc(-c3ccccc3)cs2)cc1C |
| InChI | InChI=1S/C17H16N2S.C2H6/c1-12-8-9-15(10-13(12)2)18-17-19-16(11-20-17)14-6-4-3-5-7-14;1-2/h3-11H,1-2H3,(H,18,19);1-2H3 |
| InChIKey | CQNFGWIEHXTCLU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |