C17H16N2OS — CID 873220
3-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]phenol (PubChem CID 873220) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]phenol.
| Compound Name | 3-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]phenol |
|---|---|
| PubChem CID | 873220 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[[4-(3,4-dimethylphenyl)-1,3-thiazol-2-yl]amino]phenol |
| SMILES | Cc1ccc(-c2csc(Nc3cccc(O)c3)n2)cc1C |
| InChI | InChI=1S/C17H16N2OS/c1-11-6-7-13(8-12(11)2)16-10-21-17(19-16)18-14-4-3-5-15(20)9-14/h3-10,20H,1-2H3,(H,18,19) |
| InChIKey | CTKNAWCAFXXDAI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |