C19H21BrN2S — CID 2858486
N,4-bis(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide (PubChem CID 2858486) has the molecular formula C19H21BrN2S and a molecular weight of 389.36 g/mol. Its IUPAC name is N,4-bis(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | N,4-bis(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 2858486 |
| Molecular Formula | C19H21BrN2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N,4-bis(3,4-dimethylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1ccc(Nc2nc(-c3ccc(C)c(C)c3)cs2)cc1C |
| InChI | InChI=1S/C19H20N2S.BrH/c1-12-5-7-16(9-14(12)3)18-11-22-19(21-18)20-17-8-6-13(2)15(4)10-17;/h5-11H,1-4H3,(H,20,21);1H |
| InChIKey | PRKDZNQXSSFCFG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |