C16H15N3S — CID 972690
N-(3,4-dimethylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine (PubChem CID 972690) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-(3,4-dimethylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 972690 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-pyridin-2-yl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccccn3)cs2)cc1C |
| InChI | InChI=1S/C16H15N3S/c1-11-6-7-13(9-12(11)2)18-16-19-15(10-20-16)14-5-3-4-8-17-14/h3-10H,1-2H3,(H,18,19) |
| InChIKey | XLPGLESRLBSAEJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |