C15H11N3O2S — CID 704429
4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 704429) has the molecular formula C15H11N3O2S and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid.
| Compound Name | 4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 704429 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[(4-pyridin-2-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c19-14(20)10-4-6-11(7-5-10)17-15-18-13(9-21-15)12-3-1-2-8-16-12/h1-9H,(H,17,18)(H,19,20) |
| InChIKey | AHSIVPPUDXPGPA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |