C21H16N4OS — CID 110492822
N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide (PubChem CID 110492822) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide.
| Compound Name | N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 110492822 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[4-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(-c3ccncc3)cs2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N4OS/c26-20(16-4-2-1-3-5-16)23-17-6-8-18(9-7-17)24-21-25-19(14-27-21)15-10-12-22-13-11-15/h1-14H,(H,23,26)(H,24,25) |
| InChIKey | ZTUGEXIIHJJBPN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |