C15H12N4OS — CID 87967858
N-[2-(pyridin-4-ylamino)-1,3-thiazol-4-yl]benzamide (PubChem CID 87967858) has the molecular formula C15H12N4OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[2-(pyridin-4-ylamino)-1,3-thiazol-4-yl]benzamide.
| Compound Name | N-[2-(pyridin-4-ylamino)-1,3-thiazol-4-yl]benzamide |
|---|---|
| PubChem CID | 87967858 |
| Molecular Formula | C15H12N4OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | N-[2-(pyridin-4-ylamino)-1,3-thiazol-4-yl]benzamide |
| SMILES | O=C(Nc1csc(Nc2ccncc2)n1)c1ccccc1 |
| InChI | InChI=1S/C15H12N4OS/c20-14(11-4-2-1-3-5-11)18-13-10-21-15(19-13)17-12-6-8-16-9-7-12/h1-10H,(H,18,20)(H,16,17,19) |
| InChIKey | PLPYFZMLJPSHRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |