C19H14N4OS — CID 24759889
N-(2-anilino-1,3-benzothiazol-4-yl)pyridine-4-carboxamide (PubChem CID 24759889) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-(2-anilino-1,3-benzothiazol-4-yl)pyridine-4-carboxamide.
| Compound Name | N-(2-anilino-1,3-benzothiazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 24759889 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(2-anilino-1,3-benzothiazol-4-yl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc2sc(Nc3ccccc3)nc12)c1ccncc1 |
| InChI | InChI=1S/C19H14N4OS/c24-18(13-9-11-20-12-10-13)22-15-7-4-8-16-17(15)23-19(25-16)21-14-5-2-1-3-6-14/h1-12H,(H,21,23)(H,22,24) |
| InChIKey | XYGAFVMJWRZAPZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |