C16H15N3OS — CID 79129777
N-[3-[(4-methyl-1,3-benzothiazol-2-yl)amino]phenyl]acetamide (PubChem CID 79129777) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[3-[(4-methyl-1,3-benzothiazol-2-yl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(4-methyl-1,3-benzothiazol-2-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 79129777 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-[3-[(4-methyl-1,3-benzothiazol-2-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(Nc2nc3c(C)cccc3s2)c1 |
| InChI | InChI=1S/C16H15N3OS/c1-10-5-3-8-14-15(10)19-16(21-14)18-13-7-4-6-12(9-13)17-11(2)20/h3-9H,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | NJPFUKIRCAGIAK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |