C10H12N4S — CID 45077657
2-methyl-1-(4-methyl-1,3-benzothiazol-2-yl)guanidine (PubChem CID 45077657) has the molecular formula C10H12N4S and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-methyl-1-(4-methyl-1,3-benzothiazol-2-yl)guanidine.
| Compound Name | 2-methyl-1-(4-methyl-1,3-benzothiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 45077657 |
| Molecular Formula | C10H12N4S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-methyl-1-(4-methyl-1,3-benzothiazol-2-yl)guanidine |
| SMILES | C/N=C(\N)Nc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C10H12N4S/c1-6-4-3-5-7-8(6)13-10(15-7)14-9(11)12-2/h3-5H,1-2H3,(H3,11,12,13,14) |
| InChIKey | WAIGKLCTMHIFRE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|