C17H15N5S2 — CID 71385419
1,2-bis(4-methyl-1,3-benzothiazol-2-yl)guanidine (PubChem CID 71385419) has the molecular formula C17H15N5S2 and a molecular weight of 353.48 g/mol. Its IUPAC name is 1,2-bis(4-methyl-1,3-benzothiazol-2-yl)guanidine.
| Compound Name | 1,2-bis(4-methyl-1,3-benzothiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 71385419 |
| Molecular Formula | C17H15N5S2 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 1,2-bis(4-methyl-1,3-benzothiazol-2-yl)guanidine |
| SMILES | Cc1cccc2sc(N=C(N)Nc3nc4c(C)cccc4s3)nc12 |
| InChI | InChI=1S/C17H15N5S2/c1-9-5-3-7-11-13(9)19-16(23-11)21-15(18)22-17-20-14-10(2)6-4-8-12(14)24-17/h3-8H,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | OIGFZBOCGYMACF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|