C16H12N4S2 — CID 154148255
bis(4-methyl-1,3-benzothiazol-2-yl)diazene (PubChem CID 154148255) has the molecular formula C16H12N4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is bis(4-methyl-1,3-benzothiazol-2-yl)diazene.
| Compound Name | bis(4-methyl-1,3-benzothiazol-2-yl)diazene |
|---|---|
| PubChem CID | 154148255 |
| Molecular Formula | C16H12N4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | bis(4-methyl-1,3-benzothiazol-2-yl)diazene |
| SMILES | Cc1cccc2sc(N=Nc3nc4c(C)cccc4s3)nc12 |
| InChI | InChI=1S/C16H12N4S2/c1-9-5-3-7-11-13(9)17-15(21-11)19-20-16-18-14-10(2)6-4-8-12(14)22-16/h3-8H,1-2H3 |
| InChIKey | MJRCBSINNBWQDU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|