C11H14N2S — CID 39106914
3-(4-methyl-1,3-benzothiazol-2-yl)propan-1-amine (PubChem CID 39106914) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 3-(4-methyl-1,3-benzothiazol-2-yl)propan-1-amine.
| Compound Name | 3-(4-methyl-1,3-benzothiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 39106914 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(4-methyl-1,3-benzothiazol-2-yl)propan-1-amine |
| SMILES | Cc1cccc2sc(CCCN)nc12 |
| InChI | InChI=1S/C11H14N2S/c1-8-4-2-5-9-11(8)13-10(14-9)6-3-7-12/h2,4-5H,3,6-7,12H2,1H3 |
| InChIKey | GOUVAMKMDZVIAZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |