C12H16N2S — CID 69228766
2-pentyl-1,3-benzothiazol-4-amine (PubChem CID 69228766) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 2-pentyl-1,3-benzothiazol-4-amine.
| Compound Name | 2-pentyl-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 69228766 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-pentyl-1,3-benzothiazol-4-amine |
| SMILES | CCCCCc1nc2c(N)cccc2s1 |
| InChI | InChI=1S/C12H16N2S/c1-2-3-4-8-11-14-12-9(13)6-5-7-10(12)15-11/h5-7H,2-4,8,13H2,1H3 |
| InChIKey | OBVQWQAOLBDSSS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|