C10H12N2S — CID 83818222
2-propan-2-yl-1,3-benzothiazol-4-amine (PubChem CID 83818222) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 2-propan-2-yl-1,3-benzothiazol-4-amine.
| Compound Name | 2-propan-2-yl-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 83818222 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-propan-2-yl-1,3-benzothiazol-4-amine |
| SMILES | CC(C)c1nc2c(N)cccc2s1 |
| InChI | InChI=1S/C10H12N2S/c1-6(2)10-12-9-7(11)4-3-5-8(9)13-10/h3-6H,11H2,1-2H3 |
| InChIKey | LXKPRJVVFIWGQS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|