C12H12N2S — CID 84784894
2-(2-propan-2-yl-1,3-benzothiazol-4-yl)acetonitrile (PubChem CID 84784894) has the molecular formula C12H12N2S and a molecular weight of 216.31 g/mol. Its IUPAC name is 2-(2-propan-2-yl-1,3-benzothiazol-4-yl)acetonitrile.
| Compound Name | 2-(2-propan-2-yl-1,3-benzothiazol-4-yl)acetonitrile |
|---|---|
| PubChem CID | 84784894 |
| Molecular Formula | C12H12N2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-(2-propan-2-yl-1,3-benzothiazol-4-yl)acetonitrile |
| SMILES | CC(C)c1nc2c(CC#N)cccc2s1 |
| InChI | InChI=1S/C12H12N2S/c1-8(2)12-14-11-9(6-7-13)4-3-5-10(11)15-12/h3-5,8H,6H2,1-2H3 |
| InChIKey | DIWMOVBTQBXJLP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |