C13H20N2S2 — CID 19850946
2,4-di(propan-2-yl)-1,3-benzothiazole;thiohydroxylamine (PubChem CID 19850946) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)-1,3-benzothiazole;thiohydroxylamine.
| Compound Name | 2,4-di(propan-2-yl)-1,3-benzothiazole;thiohydroxylamine |
|---|---|
| PubChem CID | 19850946 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2,4-di(propan-2-yl)-1,3-benzothiazole;thiohydroxylamine |
| SMILES | CC(C)c1nc2c(C(C)C)cccc2s1.NS |
| InChI | InChI=1S/C13H17NS.H3NS/c1-8(2)10-6-5-7-11-12(10)14-13(15-11)9(3)4;1-2/h5-9H,1-4H3;2H,1H2 |
| InChIKey | OCJXWJSPQKTOFM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|