C12H17N3S — CID 82191542
N'-(4-propan-2-yl-1,3-benzothiazol-2-yl)ethane-1,2-diamine (PubChem CID 82191542) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N'-(4-propan-2-yl-1,3-benzothiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(4-propan-2-yl-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82191542 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N'-(4-propan-2-yl-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
| SMILES | CC(C)c1cccc2sc(NCCN)nc12 |
| InChI | InChI=1S/C12H17N3S/c1-8(2)9-4-3-5-10-11(9)15-12(16-10)14-7-6-13/h3-5,8H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | BLNOCUJZICGFPN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |