C16H17N3OS2 — CID 121082867
1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 121082867) has the molecular formula C16H17N3OS2 and a molecular weight of 331.47 g/mol. Its IUPAC name is 1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 121082867 |
| Molecular Formula | C16H17N3OS2 |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-(4-propan-2-yl-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | CC(C)c1cccc2sc(NC(=O)NCc3cccs3)nc12 |
| InChI | InChI=1S/C16H17N3OS2/c1-10(2)12-6-3-7-13-14(12)18-16(22-13)19-15(20)17-9-11-5-4-8-21-11/h3-8,10H,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | CHWFDNKTYMYSBZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |