C13H9F2N3OS2 — CID 121082419
1-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 121082419) has the molecular formula C13H9F2N3OS2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 1-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 121082419 |
| Molecular Formula | C13H9F2N3OS2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 1-(4,6-difluoro-1,3-benzothiazol-2-yl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1cccs1)Nc1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C13H9F2N3OS2/c14-7-4-9(15)11-10(5-7)21-13(17-11)18-12(19)16-6-8-2-1-3-20-8/h1-5H,6H2,(H2,16,17,18,19) |
| InChIKey | OUXHOJOXQCGVLZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |