C13H13FN2OS — CID 3700183
1-[(4-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 3700183) has the molecular formula C13H13FN2OS and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 3700183 |
| Molecular Formula | C13H13FN2OS |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccc(F)cc1)NCc1cccs1 |
| InChI | InChI=1S/C13H13FN2OS/c14-11-5-3-10(4-6-11)8-15-13(17)16-9-12-2-1-7-18-12/h1-7H,8-9H2,(H2,15,16,17) |
| InChIKey | JGYBUBMLMUTYFB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |