C9H12N2OS — CID 110706901
1-prop-2-enyl-3-(thiophen-2-ylmethyl)urea (PubChem CID 110706901) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-prop-2-enyl-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 110706901 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-prop-2-enyl-3-(thiophen-2-ylmethyl)urea |
| SMILES | C=CCNC(=O)NCc1cccs1 |
| InChI | InChI=1S/C9H12N2OS/c1-2-5-10-9(12)11-7-8-4-3-6-13-8/h2-4,6H,1,5,7H2,(H2,10,11,12) |
| InChIKey | NCKMUFDHGQJIBQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|