C14H14N2O2S2 — CID 121131918
1-prop-2-enyl-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea (PubChem CID 121131918) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea.
| Compound Name | 1-prop-2-enyl-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea |
|---|---|
| PubChem CID | 121131918 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 1-prop-2-enyl-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea |
| SMILES | C=CCNC(=O)NCc1ccc(C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-2-7-15-14(18)16-9-10-5-6-12(20-10)13(17)11-4-3-8-19-11/h2-6,8H,1,7,9H2,(H2,15,16,18) |
| InChIKey | FLNYIHRUOFJPNU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|