C17H12FNO2S2 — CID 121131635
3-fluoro-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]benzamide (PubChem CID 121131635) has the molecular formula C17H12FNO2S2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-fluoro-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]benzamide.
| Compound Name | 3-fluoro-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 121131635 |
| Molecular Formula | C17H12FNO2S2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 3-fluoro-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(=O)c2cccs2)s1)c1cccc(F)c1 |
| InChI | InChI=1S/C17H12FNO2S2/c18-12-4-1-3-11(9-12)17(21)19-10-13-6-7-15(23-13)16(20)14-5-2-8-22-14/h1-9H,10H2,(H,19,21) |
| InChIKey | FLSIJUWZGXTBEE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |