C14H11N3O2S3 — CID 121131639
4-methyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiadiazole-5-carboxamide (PubChem CID 121131639) has the molecular formula C14H11N3O2S3 and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-methyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121131639 |
| Molecular Formula | C14H11N3O2S3 |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-methyl-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCc1ccc(C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C14H11N3O2S3/c1-8-13(22-17-16-8)14(19)15-7-9-4-5-11(21-9)12(18)10-3-2-6-20-10/h2-6H,7H2,1H3,(H,15,19) |
| InChIKey | KYAISFWZNXTCQH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |