C9H9N3O2S — CID 7576752
N-(furan-2-ylmethyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 7576752) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 7576752 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCc1ccco1 |
| InChI | InChI=1S/C9H9N3O2S/c1-6-8(15-12-11-6)9(13)10-5-7-3-2-4-14-7/h2-4H,5H2,1H3,(H,10,13) |
| InChIKey | XJZNMVOIVOONCF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |