C13H13N5OS2 — CID 71797383
4-methyl-N-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]thiadiazole-5-carboxamide (PubChem CID 71797383) has the molecular formula C13H13N5OS2 and a molecular weight of 319.42 g/mol. Its IUPAC name is 4-methyl-N-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 71797383 |
| Molecular Formula | C13H13N5OS2 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 4-methyl-N-[(1-methyl-5-thiophen-2-ylpyrazol-3-yl)methyl]thiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCc1cc(-c2cccs2)n(C)n1 |
| InChI | InChI=1S/C13H13N5OS2/c1-8-12(21-17-15-8)13(19)14-7-9-6-10(18(2)16-9)11-4-3-5-20-11/h3-6H,7H2,1-2H3,(H,14,19) |
| InChIKey | FYGPFGSPUUGZJA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |