C17H19N5OS2 — CID 71797450
N-[(1-cyclopentyl-5-thiophen-2-ylpyrazol-3-yl)methyl]-4-methylthiadiazole-5-carboxamide (PubChem CID 71797450) has the molecular formula C17H19N5OS2 and a molecular weight of 373.51 g/mol. Its IUPAC name is N-[(1-cyclopentyl-5-thiophen-2-ylpyrazol-3-yl)methyl]-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-[(1-cyclopentyl-5-thiophen-2-ylpyrazol-3-yl)methyl]-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 71797450 |
| Molecular Formula | C17H19N5OS2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[(1-cyclopentyl-5-thiophen-2-ylpyrazol-3-yl)methyl]-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)NCc1cc(-c2cccs2)n(C2CCCC2)n1 |
| InChI | InChI=1S/C17H19N5OS2/c1-11-16(25-21-19-11)17(23)18-10-12-9-14(15-7-4-8-24-15)22(20-12)13-5-2-3-6-13/h4,7-9,13H,2-3,5-6,10H2,1H3,(H,18,23) |
| InChIKey | KZYFOJGJYUTFIC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |