C20H13NO4S2 — CID 121131705
2-oxo-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]chromene-3-carboxamide (PubChem CID 121131705) has the molecular formula C20H13NO4S2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-oxo-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 121131705 |
| Molecular Formula | C20H13NO4S2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2-oxo-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]chromene-3-carboxamide |
| SMILES | O=C(c1cccs1)c1ccc(CNC(=O)c2cc3ccccc3oc2=O)s1 |
| InChI | InChI=1S/C20H13NO4S2/c22-18(16-6-3-9-26-16)17-8-7-13(27-17)11-21-19(23)14-10-12-4-1-2-5-15(12)25-20(14)24/h1-10H,11H2,(H,21,23) |
| InChIKey | XCKFQOFOMNPMFQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|