C21H16N2O3S — CID 108737563
N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-oxochromene-3-carboxamide (PubChem CID 108737563) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 108737563 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[(2-benzyl-1,3-thiazol-4-yl)methyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCc1csc(Cc2ccccc2)n1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C21H16N2O3S/c24-20(17-11-15-8-4-5-9-18(15)26-21(17)25)22-12-16-13-27-19(23-16)10-14-6-2-1-3-7-14/h1-9,11,13H,10,12H2,(H,22,24) |
| InChIKey | MGGQYPUIEADTHE-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|