C17H16N2O3S — CID 110440714
N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-oxochromene-3-carboxamide (PubChem CID 110440714) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110440714 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-oxochromene-3-carboxamide |
| SMILES | Cc1csc(CCCNC(=O)c2cc3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C17H16N2O3S/c1-11-10-23-15(19-11)7-4-8-18-16(20)13-9-12-5-2-3-6-14(12)22-17(13)21/h2-3,5-6,9-10H,4,7-8H2,1H3,(H,18,20) |
| InChIKey | JFBJTVRUTMHWNJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|