C23H18FN3O4S — CID 90866689
N-[2-(2-fluorophenyl)ethyl]-2-[[(2-oxochromene-3-carbonyl)amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 90866689) has the molecular formula C23H18FN3O4S and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-2-[[(2-oxochromene-3-carbonyl)amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-2-[[(2-oxochromene-3-carbonyl)amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90866689 |
| Molecular Formula | C23H18FN3O4S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-2-[[(2-oxochromene-3-carbonyl)amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1F)c1csc(CNC(=O)c2cc3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C23H18FN3O4S/c24-17-7-3-1-5-14(17)9-10-25-22(29)18-13-32-20(27-18)12-26-21(28)16-11-15-6-2-4-8-19(15)31-23(16)30/h1-8,11,13H,9-10,12H2,(H,25,29)(H,26,28) |
| InChIKey | MYNDVBUAXBSYHC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|