C17H13NO3S2 — CID 121131633
(E)-3-(furan-2-yl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]prop-2-enamide (PubChem CID 121131633) has the molecular formula C17H13NO3S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 121131633 |
| Molecular Formula | C17H13NO3S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)NCc1ccc(C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C17H13NO3S2/c19-16(8-5-12-3-1-9-21-12)18-11-13-6-7-15(23-13)17(20)14-4-2-10-22-14/h1-10H,11H2,(H,18,19)/b8-5+ |
| InChIKey | GVMMZMNSNLITQJ-VMPITWQZSA-N |
| XLogP | 3.96 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|