C20H20N2O2S2 — CID 121131937
1-(3-phenylpropyl)-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea (PubChem CID 121131937) has the molecular formula C20H20N2O2S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is 1-(3-phenylpropyl)-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea.
| Compound Name | 1-(3-phenylpropyl)-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea |
|---|---|
| PubChem CID | 121131937 |
| Molecular Formula | C20H20N2O2S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 1-(3-phenylpropyl)-3-[[5-(thiophene-2-carbonyl)thiophen-2-yl]methyl]urea |
| SMILES | O=C(NCCCc1ccccc1)NCc1ccc(C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C20H20N2O2S2/c23-19(17-9-5-13-25-17)18-11-10-16(26-18)14-22-20(24)21-12-4-8-15-6-2-1-3-7-15/h1-3,5-7,9-11,13H,4,8,12,14H2,(H2,21,22,24) |
| InChIKey | MZCKNBGEVUDPGQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|