C15H19N3OS — CID 86841626
1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropyl)urea (PubChem CID 86841626) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropyl)urea.
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropyl)urea |
|---|---|
| PubChem CID | 86841626 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]-3-(3-phenylpropyl)urea |
| SMILES | Cc1ncc(CNC(=O)NCCCc2ccccc2)s1 |
| InChI | InChI=1S/C15H19N3OS/c1-12-17-10-14(20-12)11-18-15(19)16-9-5-8-13-6-3-2-4-7-13/h2-4,6-7,10H,5,8-9,11H2,1H3,(H2,16,18,19) |
| InChIKey | MJCRRCCMBFUBFO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|