C17H22N2O2S — CID 60530184
1-[3-(2-phenylethoxy)propyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 60530184) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[3-(2-phenylethoxy)propyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[3-(2-phenylethoxy)propyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 60530184 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[3-(2-phenylethoxy)propyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCCCOCCc1ccccc1)NCc1cccs1 |
| InChI | InChI=1S/C17H22N2O2S/c20-17(19-14-16-8-4-13-22-16)18-10-5-11-21-12-9-15-6-2-1-3-7-15/h1-4,6-8,13H,5,9-12,14H2,(H2,18,19,20) |
| InChIKey | DVIJHMIWRHXFLG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|