C14H16N2O2S2 — CID 95770892
1-[2-[(S)-phenylsulfinyl]ethyl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 95770892) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 1-[2-[(S)-phenylsulfinyl]ethyl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[2-[(S)-phenylsulfinyl]ethyl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 95770892 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-[2-[(S)-phenylsulfinyl]ethyl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCC[S@](=O)c1ccccc1)NCc1cccs1 |
| InChI | InChI=1S/C14H16N2O2S2/c17-14(16-11-12-5-4-9-19-12)15-8-10-20(18)13-6-2-1-3-7-13/h1-7,9H,8,10-11H2,(H2,15,16,17)/t20-/m0/s1 |
| InChIKey | VNBIRZNEKUIBOR-FQEVSTJZSA-N |
| XLogP | 2.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |