C20H27N3O4S — CID 55934144
1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[3-(2-phenylethoxy)propyl]urea (PubChem CID 55934144) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[3-(2-phenylethoxy)propyl]urea.
| Compound Name | 1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[3-(2-phenylethoxy)propyl]urea |
|---|---|
| PubChem CID | 55934144 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-[[3-(methylsulfamoyl)phenyl]methyl]-3-[3-(2-phenylethoxy)propyl]urea |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)NCCCOCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H27N3O4S/c1-21-28(25,26)19-10-5-9-18(15-19)16-23-20(24)22-12-6-13-27-14-11-17-7-3-2-4-8-17/h2-5,7-10,15,21H,6,11-14,16H2,1H3,(H2,22,23,24) |
| InChIKey | QZLSFSFFKXUBHC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|