C12H8FN3OS2 — CID 121082399
1-(4-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea (PubChem CID 121082399) has the molecular formula C12H8FN3OS2 and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(4-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea.
| Compound Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 121082399 |
| Molecular Formula | C12H8FN3OS2 |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 1-(4-fluoro-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
| SMILES | O=C(Nc1cccs1)Nc1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C12H8FN3OS2/c13-7-3-1-4-8-10(7)15-12(19-8)16-11(17)14-9-5-2-6-18-9/h1-6H,(H2,14,15,16,17) |
| InChIKey | LAYTUAINZKMAFU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |