C11H11FN2OS — CID 7193256
N-(4-fluoro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 7193256) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 7193256 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCCC(=O)Nc1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C11H11FN2OS/c1-2-4-9(15)13-11-14-10-7(12)5-3-6-8(10)16-11/h3,5-6H,2,4H2,1H3,(H,13,14,15) |
| InChIKey | RBKURMGEDXDOGK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |