C13H15FN2O2S — CID 134714245
2-ethoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylpropanamide (PubChem CID 134714245) has the molecular formula C13H15FN2O2S and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-ethoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylpropanamide.
| Compound Name | 2-ethoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 134714245 |
| Molecular Formula | C13H15FN2O2S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-ethoxy-N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methylpropanamide |
| SMILES | CCOC(C)(C)C(=O)Nc1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C13H15FN2O2S/c1-4-18-13(2,3)11(17)16-12-15-10-8(14)6-5-7-9(10)19-12/h5-7H,4H2,1-3H3,(H,15,16,17) |
| InChIKey | QJYXPWDVZITJEB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |