C10H9FN2O2S — CID 53269300
N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methoxyacetamide (PubChem CID 53269300) has the molecular formula C10H9FN2O2S and a molecular weight of 240.26 g/mol. Its IUPAC name is N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methoxyacetamide.
| Compound Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 53269300 |
| Molecular Formula | C10H9FN2O2S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | N-(4-fluoro-1,3-benzothiazol-2-yl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1nc2c(F)cccc2s1 |
| InChI | InChI=1S/C10H9FN2O2S/c1-15-5-8(14)12-10-13-9-6(11)3-2-4-7(9)16-10/h2-4H,5H2,1H3,(H,12,13,14) |
| InChIKey | BHZDWCXHXUWFCP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |