C17H15FN2O2S — CID 53269358
2-(3,4-dimethylphenoxy)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 53269358) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(3,4-dimethylphenoxy)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 53269358 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)-N-(4-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1ccc(OCC(=O)Nc2nc3c(F)cccc3s2)cc1C |
| InChI | InChI=1S/C17H15FN2O2S/c1-10-6-7-12(8-11(10)2)22-9-15(21)19-17-20-16-13(18)4-3-5-14(16)23-17/h3-8H,9H2,1-2H3,(H,19,20,21) |
| InChIKey | WKNHZRSNUQJOCW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |